C20H29N5O3 — CID 111925581
1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine (PubChem CID 111925581) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111925581 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)NC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C20H29N5O3/c1-13-14(2)28-19(23-13)11-22-20(21-3)24-15-6-7-25(12-15)16-8-17(26-4)10-18(9-16)27-5/h8-10,15H,6-7,11-12H2,1-5H3,(H2,21,22,24) |
| InChIKey | JZEIGHAMZKQKDQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|