C17H24N6O2 — CID 119150327
1-[1-(3-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine (PubChem CID 119150327) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[1-(3-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine.
| Compound Name | 1-[1-(3-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119150327 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[1-(3-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1nc(C)no1)NC1CCN(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C17H24N6O2/c1-12-20-16(25-22-12)10-19-17(18-2)21-13-7-8-23(11-13)14-5-4-6-15(9-14)24-3/h4-6,9,13H,7-8,10-11H2,1-3H3,(H2,18,19,21) |
| InChIKey | ZZGVEYJBWCJWKM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|