C19H27ClN6O2 — CID 111917327
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111917327) has the molecular formula C19H27ClN6O2 and a molecular weight of 406.92 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111917327 |
| Molecular Formula | C19H27ClN6O2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCc1nc(C)no1)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C19H27ClN6O2/c1-13-23-18(28-25-13)5-4-9-22-19(21-2)24-15-8-10-26(12-15)16-11-14(20)6-7-17(16)27-3/h6-7,11,15H,4-5,8-10,12H2,1-3H3,(H2,21,22,24) |
| InChIKey | JYGNNZVKBYGKLC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|