C18H25BrN6O — CID 111922521
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111922521) has the molecular formula C18H25BrN6O and a molecular weight of 421.34 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111922521 |
| Molecular Formula | C18H25BrN6O |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCc1nc(C)no1)NC1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C18H25BrN6O/c1-13-22-17(26-24-13)8-5-10-21-18(20-2)23-14-9-11-25(12-14)16-7-4-3-6-15(16)19/h3-4,6-7,14H,5,8-12H2,1-2H3,(H2,20,21,23) |
| InChIKey | LKEWNMNBWDPGNQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|