C20H30BrIN6O — CID 111922666
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide (PubChem CID 111922666) has the molecular formula C20H30BrIN6O and a molecular weight of 577.31 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111922666 |
| Molecular Formula | C20H30BrIN6O |
| Molecular Weight | 577.31 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C(C)C)no1)NC1CCN(c2ccccc2Br)C1.I |
| InChI | InChI=1S/C20H29BrN6O.HI/c1-14(2)19-25-18(28-26-19)9-6-11-23-20(22-3)24-15-10-12-27(13-15)17-8-5-4-7-16(17)21;/h4-5,7-8,14-15H,6,9-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | SODGUPAJENOLPU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|