C23H27ClIN5O2 — CID 111917482
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111917482) has the molecular formula C23H27ClIN5O2 and a molecular weight of 567.86 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111917482 |
| Molecular Formula | C23H27ClIN5O2 |
| Molecular Weight | 567.86 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(-c2ccccc2)on1)NC1CCN(c2cc(Cl)ccc2OC)C1.I |
| InChI | InChI=1S/C23H26ClN5O2.HI/c1-25-23(26-14-19-13-22(31-28-19)16-6-4-3-5-7-16)27-18-10-11-29(15-18)20-12-17(24)8-9-21(20)30-2;/h3-9,12-13,18H,10-11,14-15H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | TYFRQJRAAYWUGD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|