C19H26ClN5O2 — CID 119150420
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methylguanidine (PubChem CID 119150420) has the molecular formula C19H26ClN5O2 and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 119150420 |
| Molecular Formula | C19H26ClN5O2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1c(C)noc1C)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C19H26ClN5O2/c1-12-16(13(2)27-24-12)10-22-19(21-3)23-15-7-8-25(11-15)17-9-14(20)5-6-18(17)26-4/h5-6,9,15H,7-8,10-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | CXTIXNAYTMURTM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|