C22H27F2IN6O — CID 111921340
1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methylguanidine;hydroiodide (PubChem CID 111921340) has the molecular formula C22H27F2IN6O and a molecular weight of 556.40 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111921340 |
| Molecular Formula | C22H27F2IN6O |
| Molecular Weight | 556.40 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc2ccccc2[nH]1)NC1CCN(c2ccccc2OC(F)F)C1.I |
| InChI | InChI=1S/C22H26F2N6O.HI/c1-25-22(26-12-10-20-28-16-6-2-3-7-17(16)29-20)27-15-11-13-30(14-15)18-8-4-5-9-19(18)31-21(23)24;/h2-9,15,21H,10-14H2,1H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | HPLKRKSGIGKYTQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|