C20H28F2IN5OS — CID 111922022
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111922022) has the molecular formula C20H28F2IN5OS and a molecular weight of 551.45 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111922022 |
| Molecular Formula | C20H28F2IN5OS |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-methyl-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C)cs1)NC1CCN(c2ccccc2OC(F)F)C1.I |
| InChI | InChI=1S/C20H27F2N5OS.HI/c1-14-13-29-18(25-14)8-5-10-24-20(23-2)26-15-9-11-27(12-15)16-6-3-4-7-17(16)28-19(21)22;/h3-4,6-7,13,15,19H,5,8-12H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | AMNGJZHHPYSWDR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|