C22H36IN5 — CID 111984174
1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[1-(2-methylpropyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 111984174) has the molecular formula C22H36IN5 and a molecular weight of 497.47 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[1-(2-methylpropyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[1-(2-methylpropyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111984174 |
| Molecular Formula | C22H36IN5 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-[1-(2-methylpropyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1c[nH]c2ccccc12)NC1CCN(CC(C)C)CC1.I |
| InChI | InChI=1S/C22H35N5.HI/c1-17(2)16-27-13-10-19(11-14-27)26-22(23-3)24-12-6-7-18-15-25-21-9-5-4-8-20(18)21;/h4-5,8-9,15,17,19,25H,6-7,10-14,16H2,1-3H3,(H2,23,24,26);1H |
| InChIKey | XGGSQIVXEXOEPF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|