C22H31N7 — CID 111984921
1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine (PubChem CID 111984921) has the molecular formula C22H31N7 and a molecular weight of 393.54 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine.
| Compound Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 111984921 |
| Molecular Formula | C22H31N7 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
| SMILES | C/N=C(\NCCCc1c[nH]c2ccccc12)NC1CCc2nc(C(C)C)nn2C1 |
| InChI | InChI=1S/C22H31N7/c1-15(2)21-27-20-11-10-17(14-29(20)28-21)26-22(23-3)24-12-6-7-16-13-25-19-9-5-4-8-18(16)19/h4-5,8-9,13,15,17,25H,6-7,10-12,14H2,1-3H3,(H2,23,24,26) |
| InChIKey | QFYADRVCWNOOIW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|