C19H32IN9 — CID 119158554
2-methyl-1-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide (PubChem CID 119158554) has the molecular formula C19H32IN9 and a molecular weight of 513.43 g/mol. Its IUPAC name is 2-methyl-1-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119158554 |
| Molecular Formula | C19H32IN9 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 2-methyl-1-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCc2nnc(C)n2C1)NC1CCc2nc(C(C)C)nn2C1.I |
| InChI | InChI=1S/C19H31N9.HI/c1-12(2)18-23-16-8-6-15(11-28(16)26-18)22-19(20-4)21-9-14-5-7-17-25-24-13(3)27(17)10-14;/h12,14-15H,5-11H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | HJAUUNJAFQJBGT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|