C18H29N9 — CID 119158551
1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine (PubChem CID 119158551) has the molecular formula C18H29N9 and a molecular weight of 371.49 g/mol. Its IUPAC name is 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine.
| Compound Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119158551 |
| Molecular Formula | C18H29N9 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methyl-3-[(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)methyl]guanidine |
| SMILES | CCc1nc2n(n1)CC(N/C(=N/C)NCC1CCc3nnc(C)n3C1)CC2 |
| InChI | InChI=1S/C18H29N9/c1-4-15-22-16-8-6-14(11-27(16)25-15)21-18(19-3)20-9-13-5-7-17-24-23-12(2)26(17)10-13/h13-14H,4-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | RFDVLHUCBSLFNI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|