C17H31N7O2S — CID 109395191
1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 109395191) has the molecular formula C17H31N7O2S and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109395191 |
| Molecular Formula | C17H31N7O2S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCc1nc2n(n1)CC(N/C(=N/C)NCC1CCN(S(C)(=O)=O)CC1)CC2 |
| InChI | InChI=1S/C17H31N7O2S/c1-4-15-21-16-6-5-14(12-24(16)22-15)20-17(18-2)19-11-13-7-9-23(10-8-13)27(3,25)26/h13-14H,4-12H2,1-3H3,(H2,18,19,20) |
| InChIKey | GFHAITQIEGTIIB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|