C16H31F2N5O2S — CID 109394976
1-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 109394976) has the molecular formula C16H31F2N5O2S and a molecular weight of 395.52 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109394976 |
| Molecular Formula | C16H31F2N5O2S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CCN(S(C)(=O)=O)CC1)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C16H31F2N5O2S/c1-19-16(21-14-5-7-22(8-6-14)12-15(17)18)20-11-13-3-9-23(10-4-13)26(2,24)25/h13-15H,3-12H2,1-2H3,(H2,19,20,21) |
| InChIKey | BAKYWZKGBYIUQF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|