C19H37F2N5O2 — CID 109394972
tert-butyl N-[2-[[N-[1-(2,2-difluoroethyl)piperidin-4-yl]-N'-methylcarbamimidoyl]amino]ethyl]-N-propylcarbamate (PubChem CID 109394972) has the molecular formula C19H37F2N5O2 and a molecular weight of 405.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[1-(2,2-difluoroethyl)piperidin-4-yl]-N'-methylcarbamimidoyl]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[N-[1-(2,2-difluoroethyl)piperidin-4-yl]-N'-methylcarbamimidoyl]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109394972 |
| Molecular Formula | C19H37F2N5O2 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | tert-butyl N-[2-[[N-[1-(2,2-difluoroethyl)piperidin-4-yl]-N'-methylcarbamimidoyl]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCN/C(=N\C)NC1CCN(CC(F)F)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H37F2N5O2/c1-6-10-26(18(27)28-19(2,3)4)13-9-23-17(22-5)24-15-7-11-25(12-8-15)14-16(20)21/h15-16H,6-14H2,1-5H3,(H2,22,23,24) |
| InChIKey | XTGLNSBJZWCAST-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|