C21H44IN5O2 — CID 111019380
tert-butyl N-[3-[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]propyl]-N-propan-2-ylcarbamate;hydroiodide (PubChem CID 111019380) has the molecular formula C21H44IN5O2 and a molecular weight of 525.52 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]propyl]-N-propan-2-ylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]propyl]-N-propan-2-ylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111019380 |
| Molecular Formula | C21H44IN5O2 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]propyl]-N-propan-2-ylcarbamate;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/C)NCCCN(C(=O)OC(C)(C)C)C(C)C)CC1.I |
| InChI | InChI=1S/C21H43N5O2.HI/c1-8-13-25-15-10-18(11-16-25)24-19(22-7)23-12-9-14-26(17(2)3)20(27)28-21(4,5)6;/h17-18H,8-16H2,1-7H3,(H2,22,23,24);1H |
| InChIKey | CAFMQUDJIJACPN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|