C14H31N5O2S — CID 111018055
1-[3-(methanesulfonamido)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111018055) has the molecular formula C14H31N5O2S and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 1-[3-(methanesulfonamido)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111018055 |
| Molecular Formula | C14H31N5O2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 1-[3-(methanesulfonamido)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/C)NCCCNS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H31N5O2S/c1-4-10-19-11-6-13(7-12-19)18-14(15-2)16-8-5-9-17-22(3,20)21/h13,17H,4-12H2,1-3H3,(H2,15,16,18) |
| InChIKey | VDSXZZSMCBOQPI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|