C11H25IN4O2S — CID 110990818
1-cyclopentyl-3-[3-(methanesulfonamido)propyl]-2-methylguanidine;hydroiodide (PubChem CID 110990818) has the molecular formula C11H25IN4O2S and a molecular weight of 404.32 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-(methanesulfonamido)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-3-[3-(methanesulfonamido)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110990818 |
| Molecular Formula | C11H25IN4O2S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1-cyclopentyl-3-[3-(methanesulfonamido)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)NC1CCCC1.I |
| InChI | InChI=1S/C11H24N4O2S.HI/c1-12-11(15-10-6-3-4-7-10)13-8-5-9-14-18(2,16)17;/h10,14H,3-9H2,1-2H3,(H2,12,13,15);1H |
| InChIKey | OLXYVVADTNFSBR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|