C21H43IN6O3 — CID 109394286
tert-butyl N-[2-[[ethylamino-[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide (PubChem CID 109394286) has the molecular formula C21H43IN6O3 and a molecular weight of 554.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[ethylamino-[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 109394286 |
| Molecular Formula | C21H43IN6O3 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide |
| SMILES | CCCN(CC/N=C(\NCC)NC1CCN(CC(=O)NC)CC1)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C21H42N6O3.HI/c1-7-12-27(20(29)30-21(3,4)5)15-11-24-19(23-8-2)25-17-9-13-26(14-10-17)16-18(28)22-6;/h17H,7-16H2,1-6H3,(H,22,28)(H2,23,24,25);1H |
| InChIKey | WPUZRNAJGFIZPH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|