C22H43IN6O3 — CID 109392805
tert-butyl N-[2-[[[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide (PubChem CID 109392805) has the molecular formula C22H43IN6O3 and a molecular weight of 566.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 109392805 |
| Molecular Formula | C22H43IN6O3 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | tert-butyl N-[2-[[[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide |
| SMILES | CCCN(CC/N=C(\NCC)N1CCN(CC(=O)NC2CC2)CC1)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C22H42N6O3.HI/c1-6-11-28(21(30)31-22(3,4)5)12-10-24-20(23-7-2)27-15-13-26(14-16-27)17-19(29)25-18-8-9-18;/h18H,6-17H2,1-5H3,(H,23,24)(H,25,29);1H |
| InChIKey | FNCHSFOBPMBMDE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|