C20H40N4O3 — CID 109395772
tert-butyl N-[2-[[[3-(ethoxymethyl)pyrrolidin-1-yl]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate (PubChem CID 109395772) has the molecular formula C20H40N4O3 and a molecular weight of 384.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[[3-(ethoxymethyl)pyrrolidin-1-yl]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[[3-(ethoxymethyl)pyrrolidin-1-yl]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109395772 |
| Molecular Formula | C20H40N4O3 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | tert-butyl N-[2-[[[3-(ethoxymethyl)pyrrolidin-1-yl]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CC/N=C(\NCC)N1CCC(COCC)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N4O3/c1-7-12-23(19(25)27-20(4,5)6)14-11-22-18(21-8-2)24-13-10-17(15-24)16-26-9-3/h17H,7-16H2,1-6H3,(H,21,22) |
| InChIKey | JSTPLJDPLJSWHT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|