C23H39IN4O3 — CID 111525865
tert-butyl N-[2-[[ethylamino-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide (PubChem CID 111525865) has the molecular formula C23H39IN4O3 and a molecular weight of 546.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[ethylamino-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111525865 |
| Molecular Formula | C23H39IN4O3 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)C(=O)OC(C)(C)C)N1CCC(COCc2ccccc2)C1.I |
| InChI | InChI=1S/C23H38N4O3.HI/c1-6-24-21(25-13-15-26(5)22(28)30-23(2,3)4)27-14-12-20(16-27)18-29-17-19-10-8-7-9-11-19;/h7-11,20H,6,12-18H2,1-5H3,(H,24,25);1H |
| InChIKey | LBZITBKEYUJEHY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|