C24H39IN4O3 — CID 111526706
tert-butyl N-cyclopropyl-N-[2-[[N-methyl-C-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]carbonimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111526706) has the molecular formula C24H39IN4O3 and a molecular weight of 558.51 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[[N-methyl-C-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]carbonimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[[N-methyl-C-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]carbonimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111526706 |
| Molecular Formula | C24H39IN4O3 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[[N-methyl-C-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]carbonimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCN(C(=O)OC(C)(C)C)C1CC1)N1CCC(COCc2ccccc2)C1.I |
| InChI | InChI=1S/C24H38N4O3.HI/c1-24(2,3)31-23(29)28(21-10-11-21)15-13-26-22(25-4)27-14-12-20(16-27)18-30-17-19-8-6-5-7-9-19;/h5-9,20-21H,10-18H2,1-4H3,(H,25,26);1H |
| InChIKey | LFHVBENGGXPNQU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|