C21H39N7O2 — CID 109395199
tert-butyl N-[2-[[ethylamino-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-N-propylcarbamate (PubChem CID 109395199) has the molecular formula C21H39N7O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[ethylamino-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109395199 |
| Molecular Formula | C21H39N7O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CC/N=C(\NCC)NC1CCc2nc(CC)nn2C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39N7O2/c1-7-13-27(20(29)30-21(4,5)6)14-12-23-19(22-9-3)24-16-10-11-18-25-17(8-2)26-28(18)15-16/h16H,7-15H2,1-6H3,(H2,22,23,24) |
| InChIKey | XSFYTGXPEOYKRT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|