C16H30IN7O2 — CID 110041091
2-[[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110041091) has the molecular formula C16H30IN7O2 and a molecular weight of 479.37 g/mol. Its IUPAC name is 2-[[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110041091 |
| Molecular Formula | C16H30IN7O2 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-[[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCc1nc2n(n1)CC(N/C(=N/CC(=O)N(C)C)NCCOC)CC2.I |
| InChI | InChI=1S/C16H29N7O2.HI/c1-5-13-20-14-7-6-12(11-23(14)21-13)19-16(17-8-9-25-4)18-10-15(24)22(2)3;/h12H,5-11H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | WDMMIHWUZYPHFS-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|