C20H36IN7O — CID 110041105
2-[[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-[(2-methylcyclohexyl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110041105) has the molecular formula C20H36IN7O and a molecular weight of 517.46 g/mol. Its IUPAC name is 2-[[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-[(2-methylcyclohexyl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-[(2-methylcyclohexyl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110041105 |
| Molecular Formula | C20H36IN7O |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-[[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-[(2-methylcyclohexyl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCc1nc2n(n1)CC(N/C(=N/CC(=O)N(C)C)NC1CCCCC1C)CC2.I |
| InChI | InChI=1S/C20H35N7O.HI/c1-5-17-24-18-11-10-15(13-27(18)25-17)22-20(21-12-19(28)26(3)4)23-16-9-7-6-8-14(16)2;/h14-16H,5-13H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | HYMGLZKUGMLWNC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|