C21H38IN7O — CID 110041157
2-[[(cyclohexylmethylamino)-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110041157) has the molecular formula C21H38IN7O and a molecular weight of 531.49 g/mol. Its IUPAC name is 2-[[(cyclohexylmethylamino)-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclohexylmethylamino)-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110041157 |
| Molecular Formula | C21H38IN7O |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[[(cyclohexylmethylamino)-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(C)c1nc2n(n1)CC(N/C(=N/CC(=O)N(C)C)NCC1CCCCC1)CC2.I |
| InChI | InChI=1S/C21H37N7O.HI/c1-15(2)20-25-18-11-10-17(14-28(18)26-20)24-21(23-13-19(29)27(3)4)22-12-16-8-6-5-7-9-16;/h15-17H,5-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | PSPKLETZPRWMMM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|