C19H36IN7O — CID 111995906
N-[2-[[ethylamino-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111995906) has the molecular formula C19H36IN7O and a molecular weight of 505.45 g/mol. Its IUPAC name is N-[2-[[ethylamino-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111995906 |
| Molecular Formula | C19H36IN7O |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[2-[[ethylamino-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)NC1CCc2nc(C(C)C)nn2C1.I |
| InChI | InChI=1S/C19H35N7O.HI/c1-7-20-18(22-11-10-21-17(27)19(4,5)6)23-14-8-9-15-24-16(13(2)3)25-26(15)12-14;/h13-14H,7-12H2,1-6H3,(H,21,27)(H2,20,22,23);1H |
| InChIKey | ZSZPCWPLQIXBHG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|