C19H28IN7O2 — CID 111995202
N-[2-[[ethylamino-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide (PubChem CID 111995202) has the molecular formula C19H28IN7O2 and a molecular weight of 513.38 g/mol. Its IUPAC name is N-[2-[[ethylamino-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111995202 |
| Molecular Formula | C19H28IN7O2 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-[2-[[ethylamino-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]ethyl]-2-hydroxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccccc1O)NC1CCc2nc(C)nn2C1.I |
| InChI | InChI=1S/C19H27N7O2.HI/c1-3-20-19(24-14-8-9-17-23-13(2)25-26(17)12-14)22-11-10-21-18(28)15-6-4-5-7-16(15)27;/h4-7,14,27H,3,8-12H2,1-2H3,(H,21,28)(H2,20,22,24);1H |
| InChIKey | DSEPFQVUVNPCIR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|