C22H33N7O — CID 111995219
2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1-ethyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine (PubChem CID 111995219) has the molecular formula C22H33N7O and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1-ethyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine.
| Compound Name | 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1-ethyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 111995219 |
| Molecular Formula | C22H33N7O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 2-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1-ethyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
| SMILES | CCN/C(=N\CC(O)CN1CCc2ccccc2C1)NC1CCc2nc(C)nn2C1 |
| InChI | InChI=1S/C22H33N7O/c1-3-23-22(26-19-8-9-21-25-16(2)27-29(21)14-19)24-12-20(30)15-28-11-10-17-6-4-5-7-18(17)13-28/h4-7,19-20,30H,3,8-15H2,1-2H3,(H2,23,24,26) |
| InChIKey | SQUXVGKRSKKTIK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|