C20H29FN6O — CID 111994157
1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine (PubChem CID 111994157) has the molecular formula C20H29FN6O and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine.
| Compound Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 111994157 |
| Molecular Formula | C20H29FN6O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)NC1CCc2nc(C(C)C)nn2C1 |
| InChI | InChI=1S/C20H29FN6O/c1-4-22-20(23-11-17(28)14-5-7-15(21)8-6-14)24-16-9-10-18-25-19(13(2)3)26-27(18)12-16/h5-8,13,16-17,28H,4,9-12H2,1-3H3,(H2,22,23,24) |
| InChIKey | JERKAEHBYCCZID-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|