C25H33FN4O — CID 111994909
1-(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine (PubChem CID 111994909) has the molecular formula C25H33FN4O and a molecular weight of 424.56 g/mol. Its IUPAC name is 1-(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine.
| Compound Name | 1-(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 111994909 |
| Molecular Formula | C25H33FN4O |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)NC1CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C25H33FN4O/c1-2-27-25(28-16-24(31)19-8-10-20(26)11-9-19)29-21-14-22-12-13-23(15-21)30(22)17-18-6-4-3-5-7-18/h3-11,21-24,31H,2,12-17H2,1H3,(H2,27,28,29) |
| InChIKey | JIOZPUFFVFCGHU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|