C20H32FIN4O — CID 111993920
1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[1-(2-methylprop-2-enyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 111993920) has the molecular formula C20H32FIN4O and a molecular weight of 490.41 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[1-(2-methylprop-2-enyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[1-(2-methylprop-2-enyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111993920 |
| Molecular Formula | C20H32FIN4O |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[1-(2-methylprop-2-enyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | C=C(C)CN1CCC(N/C(=N/CC(O)c2ccc(F)cc2)NCC)CC1.I |
| InChI | InChI=1S/C20H31FN4O.HI/c1-4-22-20(23-13-19(26)16-5-7-17(21)8-6-16)24-18-9-11-25(12-10-18)14-15(2)3;/h5-8,18-19,26H,2,4,9-14H2,1,3H3,(H2,22,23,24);1H |
| InChIKey | MUAXKTJDHDUCMS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|