C15H24IN3O — CID 110988948
1-cyclopropyl-3-ethyl-2-[2-hydroxy-2-(4-methylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 110988948) has the molecular formula C15H24IN3O and a molecular weight of 389.28 g/mol. Its IUPAC name is 1-cyclopropyl-3-ethyl-2-[2-hydroxy-2-(4-methylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-3-ethyl-2-[2-hydroxy-2-(4-methylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110988948 |
| Molecular Formula | C15H24IN3O |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-cyclopropyl-3-ethyl-2-[2-hydroxy-2-(4-methylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(C)cc1)NC1CC1.I |
| InChI | InChI=1S/C15H23N3O.HI/c1-3-16-15(18-13-8-9-13)17-10-14(19)12-6-4-11(2)5-7-12;/h4-7,13-14,19H,3,8-10H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | WCDXXHYWZXYULQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|