C18H25ClF3N3O — CID 111989979
2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine (PubChem CID 111989979) has the molecular formula C18H25ClF3N3O and a molecular weight of 391.87 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine |
|---|---|
| PubChem CID | 111989979 |
| Molecular Formula | C18H25ClF3N3O |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)cc1)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H25ClF3N3O/c1-2-23-17(24-11-16(26)12-3-7-14(19)8-4-12)25-15-9-5-13(6-10-15)18(20,21)22/h3-4,7-8,13,15-16,26H,2,5-6,9-11H2,1H3,(H2,23,24,25) |
| InChIKey | PMLKGIGTCHUMRE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|