C16H28IN7O — CID 110040805
N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110040805) has the molecular formula C16H28IN7O and a molecular weight of 461.35 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110040805 |
| Molecular Formula | C16H28IN7O |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)NC1CCc2nc(C)nn2C1.I |
| InChI | InChI=1S/C16H27N7O.HI/c1-11(2)8-17-16(18-9-15(24)22(4)5)20-13-6-7-14-19-12(3)21-23(14)10-13;/h13H,1,6-10H2,2-5H3,(H2,17,18,20);1H |
| InChIKey | MPFSGHQLJIEHBI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|