C18H27IN6O — CID 110055559
1-[2-(furan-2-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide (PubChem CID 110055559) has the molecular formula C18H27IN6O and a molecular weight of 470.36 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110055559 |
| Molecular Formula | C18H27IN6O |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(2-methylprop-2-enyl)-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\NCCc1ccco1)NC1CCc2nc(C)nn2C1.I |
| InChI | InChI=1S/C18H26N6O.HI/c1-13(2)11-20-18(19-9-8-16-5-4-10-25-16)22-15-6-7-17-21-14(3)23-24(17)12-15;/h4-5,10,15H,1,6-9,11-12H2,2-3H3,(H2,19,20,22);1H |
| InChIKey | LLIFCQNUWHSSEU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|