C18H28N6O3 — CID 110059354
1-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]guanidine (PubChem CID 110059354) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]guanidine |
|---|---|
| PubChem CID | 110059354 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]guanidine |
| SMILES | COCC/N=C(\NCCc1ccco1)NC1CCc2nc(COC)nn2C1 |
| InChI | InChI=1S/C18H28N6O3/c1-25-11-9-20-18(19-8-7-15-4-3-10-27-15)21-14-5-6-17-22-16(13-26-2)23-24(17)12-14/h3-4,10,14H,5-9,11-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | AUXAOEJWELYCEP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|