C23H31IN6OS — CID 110055799
1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[2-(furan-2-yl)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 110055799) has the molecular formula C23H31IN6OS and a molecular weight of 566.51 g/mol. Its IUPAC name is 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[2-(furan-2-yl)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[2-(furan-2-yl)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110055799 |
| Molecular Formula | C23H31IN6OS |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[2-(furan-2-yl)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCc1nc2n(n1)CC(N/C(=N/CCc1ccco1)NCCSc1ccccc1)CC2.I |
| InChI | InChI=1S/C23H30N6OS.HI/c1-2-21-27-22-11-10-18(17-29(22)28-21)26-23(24-13-12-19-7-6-15-30-19)25-14-16-31-20-8-4-3-5-9-20;/h3-9,15,18H,2,10-14,16-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | BSGDFPYGLWLUNS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|