C19H30N6O2 — CID 110059352
2-butyl-1-[2-(furan-2-yl)ethyl]-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]guanidine (PubChem CID 110059352) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-butyl-1-[2-(furan-2-yl)ethyl]-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]guanidine.
| Compound Name | 2-butyl-1-[2-(furan-2-yl)ethyl]-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]guanidine |
|---|---|
| PubChem CID | 110059352 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2-butyl-1-[2-(furan-2-yl)ethyl]-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]guanidine |
| SMILES | CCCC/N=C(\NCCc1ccco1)NC1CCc2nc(COC)nn2C1 |
| InChI | InChI=1S/C19H30N6O2/c1-3-4-10-20-19(21-11-9-16-6-5-12-27-16)22-15-7-8-18-23-17(14-26-2)24-25(18)13-15/h5-6,12,15H,3-4,7-11,13-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | MHCFZJRSCWMJDA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|