C22H31IN4O3S — CID 110055243
methyl 4-[[N'-[2-(furan-2-yl)ethyl]-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 110055243) has the molecular formula C22H31IN4O3S and a molecular weight of 558.49 g/mol. Its IUPAC name is methyl 4-[[N'-[2-(furan-2-yl)ethyl]-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | methyl 4-[[N'-[2-(furan-2-yl)ethyl]-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110055243 |
| Molecular Formula | C22H31IN4O3S |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | methyl 4-[[N'-[2-(furan-2-yl)ethyl]-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | COC(=O)N1CCC(N/C(=N/CCc2ccco2)NCCSc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H30N4O3S.HI/c1-28-22(27)26-14-10-18(11-15-26)25-21(23-12-9-19-6-5-16-29-19)24-13-17-30-20-7-3-2-4-8-20;/h2-8,16,18H,9-15,17H2,1H3,(H2,23,24,25);1H |
| InChIKey | AGNTUIJWPXBIEG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|