C20H32IN5O3S — CID 110040424
methyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 110040424) has the molecular formula C20H32IN5O3S and a molecular weight of 549.48 g/mol. Its IUPAC name is methyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | methyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110040424 |
| Molecular Formula | C20H32IN5O3S |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | methyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | COC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCCSc2ccccc2)CC1.I |
| InChI | InChI=1S/C20H31N5O3S.HI/c1-24(2)18(26)15-22-19(21-11-14-29-17-7-5-4-6-8-17)23-16-9-12-25(13-10-16)20(27)28-3;/h4-8,16H,9-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | KXZGEFGXVYEVBD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|