C21H34ClN5OS — CID 111763983
2-[[[2-(4-chlorophenyl)sulfanylethylamino]-[(1-propylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111763983) has the molecular formula C21H34ClN5OS and a molecular weight of 440.06 g/mol. Its IUPAC name is 2-[[[2-(4-chlorophenyl)sulfanylethylamino]-[(1-propylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(4-chlorophenyl)sulfanylethylamino]-[(1-propylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111763983 |
| Molecular Formula | C21H34ClN5OS |
| Molecular Weight | 440.06 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 2-[[[2-(4-chlorophenyl)sulfanylethylamino]-[(1-propylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCN1CCC(N/C(=N/CC(=O)N(C)C)NCCSc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H34ClN5OS/c1-4-12-27-13-9-18(10-14-27)25-21(24-16-20(28)26(2)3)23-11-15-29-19-7-5-17(22)6-8-19/h5-8,18H,4,9-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | PXQVUIYJTOUHEG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.06 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|