C20H31F2N5OS — CID 110039985
2-[[[[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]amino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110039985) has the molecular formula C20H31F2N5OS and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[[[[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]amino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]amino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110039985 |
| Molecular Formula | C20H31F2N5OS |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-[[[[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]amino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)NC1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H31F2N5OS/c1-26(2)19(28)13-24-20(23-8-11-29-3)25-16-6-9-27(10-7-16)14-15-4-5-17(21)18(22)12-15/h4-5,12,16H,6-11,13-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | XAWMIRUXRPVIOK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|