C19H29Cl2N5O — CID 110050040
2-[[[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110050040) has the molecular formula C19H29Cl2N5O and a molecular weight of 414.38 g/mol. Its IUPAC name is 2-[[[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110050040 |
| Molecular Formula | C19H29Cl2N5O |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-[[[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NC1CCN(Cc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H29Cl2N5O/c1-4-22-19(23-12-18(27)25(2)3)24-17-5-7-26(8-6-17)13-14-9-15(20)11-16(21)10-14/h9-11,17H,4-8,12-13H2,1-3H3,(H2,22,23,24) |
| InChIKey | LMVFCKHETJKAMD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|