C21H33Cl2N5O — CID 110050048
2-[[(butan-2-ylamino)-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110050048) has the molecular formula C21H33Cl2N5O and a molecular weight of 442.44 g/mol. Its IUPAC name is 2-[[(butan-2-ylamino)-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(butan-2-ylamino)-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110050048 |
| Molecular Formula | C21H33Cl2N5O |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-[[(butan-2-ylamino)-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC(C)N/C(=N\CC(=O)N(C)C)NC1CCN(Cc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H33Cl2N5O/c1-5-15(2)25-21(24-13-20(29)27(3)4)26-19-6-8-28(9-7-19)14-16-10-17(22)12-18(23)11-16/h10-12,15,19H,5-9,13-14H2,1-4H3,(H2,24,25,26) |
| InChIKey | VIQJDSIYVAVMAB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|