C25H35FIN5O — CID 110039236
2-[[[[1-[(4-fluorophenyl)methyl]piperidin-4-yl]amino]-(1-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110039236) has the molecular formula C25H35FIN5O and a molecular weight of 567.49 g/mol. Its IUPAC name is 2-[[[[1-[(4-fluorophenyl)methyl]piperidin-4-yl]amino]-(1-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[1-[(4-fluorophenyl)methyl]piperidin-4-yl]amino]-(1-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110039236 |
| Molecular Formula | C25H35FIN5O |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 2-[[[[1-[(4-fluorophenyl)methyl]piperidin-4-yl]amino]-(1-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(N/C(=N\CC(=O)N(C)C)NC1CCN(Cc2ccc(F)cc2)CC1)c1ccccc1.I |
| InChI | InChI=1S/C25H34FN5O.HI/c1-19(21-7-5-4-6-8-21)28-25(27-17-24(32)30(2)3)29-23-13-15-31(16-14-23)18-20-9-11-22(26)12-10-20;/h4-12,19,23H,13-18H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | AZFOFWROAPXSNY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|