C27H40IN5O — CID 111621583
2-[[[(1-benzylpiperidin-4-yl)amino]-[2-(4-methylphenyl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111621583) has the molecular formula C27H40IN5O and a molecular weight of 577.56 g/mol. Its IUPAC name is 2-[[[(1-benzylpiperidin-4-yl)amino]-[2-(4-methylphenyl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(1-benzylpiperidin-4-yl)amino]-[2-(4-methylphenyl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111621583 |
| Molecular Formula | C27H40IN5O |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 2-[[[(1-benzylpiperidin-4-yl)amino]-[2-(4-methylphenyl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | Cc1ccc(C(C)CN/C(=N\CC(=O)N(C)C)NC2CCN(Cc3ccccc3)CC2)cc1.I |
| InChI | InChI=1S/C27H39N5O.HI/c1-21-10-12-24(13-11-21)22(2)18-28-27(29-19-26(33)31(3)4)30-25-14-16-32(17-15-25)20-23-8-6-5-7-9-23;/h5-13,22,25H,14-20H2,1-4H3,(H2,28,29,30);1H |
| InChIKey | KUGGYFMGIDJHBI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|