C14H27F3IN5OS — CID 111907240
N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111907240) has the molecular formula C14H27F3IN5OS and a molecular weight of 497.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111907240 |
| Molecular Formula | C14H27F3IN5OS |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C14H26F3N5OS.HI/c1-21(2)12(23)8-19-13(18-5-7-24-3)20-11-4-6-22(9-11)10-14(15,16)17;/h11H,4-10H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | GUYLPBAQOWKUBK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|